ChemIndex - Pangkalan data CAS kimia percumaChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Bromo-4-methylacetanilide |
|
Nama produk | 2-Bromo-4-methylacetanilide |
Nama Inggeris | 2-Bromo-4-methylacetanilide;2-Bromo-4-methylactanilide;N-(2-bromo-4-methylphenyl)acetamide |
MF | C9H10BrNO |
Berat Molekul | 228.0858 |
InChI | InChI=1/C9H10BrNO/c1-6-3-4-9(8(10)5-6)11-7(2)12/h3-5H,1-2H3,(H,11,12) |
CAS NO | 614-83-5 |
Struktur Molekul | |
Kepadatan | 1.471g/cm3 |
Titik lebur | 117-119℃ |
Titik didih | 349.9°C at 760 mmHg |
Indeks bias | 1.6 |
Titik nyala | 165.4°C |
Tekanan wap | 4.57E-05mmHg at 25°C |
Keselamatan Penerangan | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |