Chemindex >613-54-7
MY ▼
alpha-Bromo-2'-acetonaphthone |
|
| Nama produk | alpha-Bromo-2'-acetonaphthone |
| Nama Inggeris | alpha-Bromo-2'-acetonaphthone;Bromomethyl 2-naphthyl ketone;alpha-Bromo-2-acetonaphthone;2-(Bromoacetyl)naphthalene;2-(Bromoacetyl)naphthalene;2-bromo-1-(naphthalen-2-yl)ethanone;α-Bromo-2-acetonaphthone;2-Bromo-2'-acetonaphthone;2-Bromo-1-(2-naphthyl)-1-ethanone |
| MF | C12H9BrO |
| Berat Molekul | 249.1033 |
| InChI | InChI=1/C12H9BrO/c13-8-12(14)11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8H2 |
| CAS NO | 613-54-7 |
| EINECS | 210-348-7 |
| Struktur Molekul |  |
| Kepadatan | 1.48g/cm3 |
| Titik lebur | 82-85℃ |
| Titik didih | 349.8°C at 760 mmHg |
| Indeks bias | 1.656 |
| Titik nyala | 99.1°C |
| Tekanan wap | 4.59E-05mmHg at 25°C |
| Cinta bahaya |  C##Corrosive:; |
| Kod Risiko | R34##Causes burns.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 