ChemIndex - Pangkalan data CAS kimia percumaChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-methylquinolin-6-ol |
|
Nama produk | 2-methylquinolin-6-ol |
Nama Inggeris | 2-methylquinolin-6-ol;6-Hydroxy-2-methylquinoline;2-Methyl-6-hydroxyquinoline;2-Methyl-6-hydroxyquinoine |
MF | C10H9NO |
Berat Molekul | 159.1846 |
InChI | InChI=1/C10H9NO/c1-7-2-3-8-6-9(12)4-5-10(8)11-7/h2-6,12H,1H3 |
CAS NO | 613-21-8 |
Struktur Molekul | |
Kepadatan | 1.21g/cm3 |
Titik lebur | 198℃ |
Titik didih | 304.5°C at 760 mmHg |
Indeks bias | 1.666 |
Titik nyala | 142.3°C |
Tekanan wap | 0.000483mmHg at 25°C |
Cinta bahaya | Xi##Irritant:; |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |