Chemindex >611-15-4
MY ▼
o-Vinyltoluene |
|
| Nama produk | o-Vinyltoluene |
| Nama Inggeris | o-Vinyltoluene;2-Methylstyrene;2-Vinyltoluene |
| MF | C9H10 |
| Berat Molekul | 118.17 |
| InChI | InChI=1/C9H10/c1-3-9-7-5-4-6-8(9)2/h3-7H,1H2,2H3 |
| CAS NO | 611-15-4 |
| EINECS | 210-256-7 |
| Struktur Molekul |  |
| Kepadatan | 0.916 |
| Kod Risiko | R20##Harmful by inhalation.||R51/53##Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:; |
| Keselamatan Penerangan | S24##Avoid contact with skin.||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati ChemNet Mall untuk bertanya tentang harga
o-Vinyltoluene 611-15-4
Pembekal untuk 611-15-4 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 