ChemIndex - Pangkalan data CAS kimia percumaChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Methyl 2-chlorobenzoate |
|
Nama produk | Methyl 2-chlorobenzoate |
Nama Inggeris | Methyl 2-chlorobenzoate;Chlorobenzoic acid methyl ester;O-Chlorobenzoic Acid Methyl Ester;2-Chlorobenzoic Acid Methyl Ester |
MF | C8H7ClO2 |
Berat Molekul | 170.593 |
InChI | InChI=1/C8H7ClO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
CAS NO | 610-96-8 |
EINECS | 210-242-0 |
Struktur Molekul | |
Kepadatan | 1.224g/cm3 |
Titik didih | 225.4°C at 760 mmHg |
Indeks bias | 1.528 |
Titik nyala | 101.7°C |
Tekanan wap | 0.0868mmHg at 25°C |
Cinta bahaya | Xi##Irritant:; |
Kod Risiko | R36/37/38:; |
Keselamatan Penerangan | S24/25##Avoid contact with skin and eyes.:; |
MSDS |