ChemIndex - Pangkalan data CAS kimia percumaChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-nitrophenyl asetat |
|
Nama produk | 2-nitrophenyl asetat |
Sinonim | ; 2-Nitrophenyl asetat; Asid asetik 2-nitrophenyl ester; |
Nama Inggeris | 2-nitrophenyl acetate;2-Nitrophenyl acetate;Acetic acid 2-nitrophenyl ester |
MF | C8H7NO4 |
Berat Molekul | 181.1455 |
InChI | InChI=1/C8H7NO4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3 |
CAS NO | 610-69-5 |
EINECS | 210-233-1 |
Struktur Molekul | |
Kepadatan | 1.304g/cm3 |
Titik lebur | 39-41℃ |
Titik didih | 274.8°C at 760 mmHg |
Indeks bias | 1.548 |
Titik nyala | 139.8°C |
Tekanan wap | 0.00528mmHg at 25°C |
Keselamatan Penerangan | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |