Chemindex >609-11-0
MY ▼
609-11-0 Ethyl 2,3-dibromobutyrate |
|
| Nama produk | Ethyl 2,3-dibromobutyrate |
| Nama Inggeris | Ethyl 2,3-dibromobutyrate;2,3-Dibromobutyric acid ethyl ester;2,3-Dibromo-n-butyric acid ethyl ester;ethyl 2,3-dibromobutanoate |
| MF | C6H10Br2O2 |
| Berat Molekul | 273.9504 |
| InChI | InChI=1/C6H10Br2O2/c1-3-10-6(9)5(8)4(2)7/h4-5H,3H2,1-2H3 |
| CAS NO | 609-11-0 |
| EINECS | 210-177-8 |
| Struktur Molekul |  |
| Kepadatan | 1.731g/cm3 |
| Titik didih | 226.7°C at 760 mmHg |
| Indeks bias | 1.506 |
| Titik nyala | 90.9°C |
| Tekanan wap | 0.0809mmHg at 25°C |
| Kod Risiko | R34##Causes burns.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 609-11-0 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 