Chemindex >604-44-4
MY ▼
604-44-4 4-Chloro-1-naphthol |
|
| Nama produk | 4-Chloro-1-naphthol |
| Nama Inggeris | 4-Chloro-1-naphthol;1-Chloro-4-hydroxynaphthalene;4-Chloro-alpha-naphthol;NSC 44345;1-Naphthalenol, 4-chloro-;1-Naphthol, 4-chloro- (8CI);4-chloronaphthalen-1-ol |
| MF | C10H7ClO |
| Berat Molekul | 178.615 |
| InChI | InChI=1/C10H7ClO/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6,12H |
| CAS NO | 604-44-4 |
| EINECS | 210-068-5 |
| Struktur Molekul |  |
| Kepadatan | 1.333g/cm3 |
| Titik lebur | 117-120℃ |
| Titik didih | 332.1°C at 760 mmHg |
| Indeks bias | 1.684 |
| Titik nyala | 154.6°C |
| Tekanan wap | 7.74E-05mmHg at 25°C |
| Cinta bahaya |  Xi##Irritant:; |
| Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 