ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58414-52-1 Methyl thiophene-3-acetate |
|
Nama produk | Methyl thiophene-3-acetate |
Nama Inggeris | Methyl thiophene-3-acetate;Methyl 3-thienylacetate~Thiophene-3-acetic acid methyl ester;3-Thiopheneacetic acid methyl ester;methyl thiophen-3-ylacetate |
MF | C7H8O2S |
Berat Molekul | 156.2022 |
InChI | InChI=1/C7H8O2S/c1-9-7(8)4-6-2-3-10-5-6/h2-3,5H,4H2,1H3 |
CAS NO | 58414-52-1 |
EINECS | 261-242-2 |
Struktur Molekul | ![]() |
Kepadatan | 1.185g/cm3 |
Titik didih | 210.4°C at 760 mmHg |
Indeks bias | 1.528 |
Titik nyala | 81.1°C |
Tekanan wap | 0.193mmHg at 25°C |
Keselamatan Penerangan | S24/25##Avoid contact with skin and eyes.:; |
MSDS |