ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54263-82-0 3-Dimethylaminobenzoyl klorida |
|
Nama produk | 3-Dimethylaminobenzoyl klorida |
Nama Inggeris | 3-Dimethylaminobenzoyl chloride; |
MF | C9H10ClNO |
Berat Molekul | 183.6348 |
InChI | InChI=1/C9H10ClNO/c1-11(2)8-5-3-4-7(6-8)9(10)12/h3-6H,1-2H3 |
CAS NO | 54263-82-0 |
Struktur Molekul | |
Kepadatan | 1.193g/cm3 |
Titik didih | 275.9°C at 760 mmHg |
Indeks bias | 1.574 |
Titik nyala | 120.7°C |
Tekanan wap | 0.00495mmHg at 25°C |
Kod Risiko | R34##Causes burns.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |