ChemIndex - Pangkalan data CAS kimia percumaChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,3-Dibromosuccinic acid |
|
Nama produk | 2,3-Dibromosuccinic acid |
Nama Inggeris | 2,3-Dibromosuccinic acid;Dibromosuccinicacid;2,3-Dibromosucinic Acid;2,3-Dibromo Dibutyric Acid;meso-2,3-Dibromosuccinic acid;(2R,3S)-2,3-dibromobutanedioic acid;(2R,3S)-2,3-dibromobutanedioate |
MF | C4H2Br2O4 |
Berat Molekul | 273.8654 |
InChI | InChI=1/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10)/p-2/t1-,2+ |
CAS NO | 526-78-3;608-35-5;608-36-6 |
EINECS | 208-396-9 |
Struktur Molekul | |
Titik lebur | 255-260℃ |
Titik didih | 262.4°C at 760 mmHg |
Titik nyala | 112.5°C |
Kelarutan air | 20 g/L (17℃) |
Tekanan wap | 0.00323mmHg at 25°C |
Cinta bahaya | Xi##Irritant:; |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S24/25##Avoid contact with skin and eyes.:; |
MSDS |