ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
520-03-6 N-phenylphthalimide |
|
Nama produk | N-phenylphthalimide |
Nama Inggeris | N-phenylphthalimide;2-PHENYL-ISOINDOLE-1,3-DIONE;PHTHALANIL;1H-Isoindole-1,3(2H)-dione, 2-phenyl-;1H-Isoindole-1,3(2H)-dione,2-phenyl-;2-Phenyl-1,3-isoindoledione;2-Phenyl-1,3-isoindolinedione;2-Phenyl-1H-isoindole-1,3(2H)-dione;2-phenyl-1h-isoindole-3(2h)-dione;n-phenyl-phthalimid;Phthalimide, N-phenyl-;Phthalimide,N-phenyl-;Phenylphthalimide;N-phenyl phthalimide |
MF | C14H9NO2 |
Berat Molekul | 223.2268 |
InChI | InChI=1/C14H9NO2/c16-13-11-8-4-5-9-12(11)14(17)15(13)10-6-2-1-3-7-10/h1-9H |
CAS NO | 520-03-6 |
EINECS | 208-282-9 |
Struktur Molekul | ![]() |
Kepadatan | 1.338g/cm3 |
Titik lebur | 204-207℃ |
Titik didih | 388.8°C at 760 mmHg |
Indeks bias | 1.667 |
Titik nyala | 182.6°C |
Tekanan wap | 2.99E-06mmHg at 25°C |
Keselamatan Penerangan | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |