ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
502-50-1 4-Ketopimelic acid |
|
Nama produk | 4-Ketopimelic acid |
Nama Inggeris | 4-Ketopimelic acid;4-Oxopimelic acid;4-oxoheptanedioic acid;4-oxoheptanedioate |
MF | C7H8O5 |
Berat Molekul | 172.1365 |
InChI | InChI=1/C7H10O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H2,(H,9,10)(H,11,12)/p-2 |
CAS NO | 502-50-1 |
EINECS | 207-941-8 |
Struktur Molekul | |
Titik lebur | 142-144℃ |
Titik didih | 420.4°C at 760 mmHg |
Titik nyala | 222.2°C |
Tekanan wap | 3.03E-08mmHg at 25°C |
Cinta bahaya | Xi##Irritant:; |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |