ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
486-70-4 lupinine |
|
Nama produk | lupinine |
Nama Inggeris | lupinine;(-)-Lupinine;(1R-trans)-Octahydro-2H-quinolizine-1-methanol;(1R,9aR)-octahydro-2H-quinolizin-1-ylmethanol;(1S,9aR)-octahydro-2H-quinolizin-1-ylmethanol |
MF | C10H19NO |
Berat Molekul | 169.264 |
InChI | InChI=1/C10H19NO/c12-8-9-4-3-7-11-6-2-1-5-10(9)11/h9-10,12H,1-8H2/t9-,10-/m1/s1 |
CAS NO | 486-70-4 |
EINECS | 207-638-0 |
Struktur Molekul | |
Kepadatan | 1.04g/cm3 |
Titik lebur | 68-69℃ |
Titik didih | 270°C at 760 mmHg |
Indeks bias | 1.525 |
Titik nyala | 99.1°C |
Tekanan wap | 0.000928mmHg at 25°C |
Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Keselamatan Penerangan | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |