ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
459-59-6 4-Fluoro-N-methylaniline |
|
Nama produk | 4-Fluoro-N-methylaniline |
Nama Inggeris | 4-Fluoro-N-methylaniline;4-Fluoro-N-toluidine |
MF | C7H8FN |
Berat Molekul | 125.1435 |
InChI | InChI=1/C7H8FN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 |
CAS NO | 459-59-6 |
EINECS | 207-294-1 |
Struktur Molekul | |
Kepadatan | 1.106g/cm3 |
Titik didih | 181.4°C at 760 mmHg |
Indeks bias | 1.546 |
Titik nyala | 63.5°C |
Tekanan wap | 0.853mmHg at 25°C |
Cinta bahaya | Xi##Irritant:; |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |