ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
458-05-9 1-(3-fluorophenyl)-2-thiourea |
|
Nama produk | 1-(3-fluorophenyl)-2-thiourea |
Nama Inggeris | 1-(3-fluorophenyl)-2-thiourea;3-Fluorophenylthiourea;1-(3-fluorophenyl)thiourea |
MF | C7H7FN2S |
Berat Molekul | 170.2073 |
InChI | InChI=1/C7H7FN2S/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,(H3,9,10,11) |
CAS NO | 458-05-9 |
Struktur Molekul | ![]() |
Kepadatan | 1.397g/cm3 |
Titik didih | 259.3°C at 760 mmHg |
Indeks bias | 1.692 |
Titik nyala | 110.6°C |
Tekanan wap | 0.0131mmHg at 25°C |
Kod Risiko | R25##Toxic if swallowed.:; |
Keselamatan Penerangan | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |