ChemIndex - Pangkalan data CAS kimia percumaChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Desyl chloride |
|
Nama produk | Desyl chloride |
Nama Inggeris | Desyl chloride;alpha-Chloro-alpha-phenylacetophenone;alpha-chlorodeoxybenzoin;2-chloro-1,2-diphenylethanone;(2R)-2-chloro-1,2-diphenylethanone;(2S)-2-chloro-1,2-diphenylethanone |
MF | C14H11ClO |
Berat Molekul | 230.6895 |
InChI | InChI=1/C14H11ClO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13H/t13-/m0/s1 |
CAS NO | 447-31-4 |
EINECS | 207-181-7 |
Struktur Molekul | |
Kepadatan | 1.19g/cm3 |
Titik lebur | 65-69℃ |
Titik didih | 345.5°C at 760 mmHg |
Indeks bias | 1.592 |
Titik nyala | 190.4°C |
Tekanan wap | 6.14E-05mmHg at 25°C |
Cinta bahaya | Xn##Harmful:; |
Kod Risiko | R20/21##Harmful by inhalation and in contact with skin.||R37##Irritating to respiratory system.:; |
Keselamatan Penerangan | S22##Do not inhale dust.||S24##Avoid contact with skin.:; |
MSDS |