ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
401-56-9 ethylchlorofluoroacetate |
|
Nama produk | ethylchlorofluoroacetate |
Nama Inggeris | ethylchlorofluoroacetate;Ethyl chlorofluoroacetate;Chlorofluoroacetic acid ethyl ester;ethyl (2S)-chloro(fluoro)ethanoate;ethyl (2R)-chloro(fluoro)ethanoate |
MF | C4H6ClFO2 |
Berat Molekul | 140.5406 |
InChI | InChI=1/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3/t3-/m0/s1 |
CAS NO | 401-56-9 |
EINECS | 206-930-5 |
Struktur Molekul | ![]() |
Kepadatan | 1.219g/cm3 |
Titik didih | 129°C at 760 mmHg |
Indeks bias | 1.39 |
Titik nyala | 44.3°C |
Tekanan wap | 10.4mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R34##Causes burns.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |