Chemindex >39493-62-4
MY ▼
39493-62-4 Methyl 4-hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate |
|
| Nama produk | Methyl 4-hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate |
| Nama Inggeris | Methyl 4-hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate;5,6-Dihydroorsellinic acid methyl ester~4-Hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate methyl ester~Methyl 5-methylcyclohexene-1,3-dione-4-carboxylate;methyl 4-hydroxy-6-methyl-2-oxocyclohex-3-ene-1-carboxylate |
| MF | C9H12O4 |
| Berat Molekul | 184.1892 |
| InChI | InChI=1/C9H12O4/c1-5-3-6(10)4-7(11)8(5)9(12)13-2/h4-5,8,10H,3H2,1-2H3 |
| CAS NO | 39493-62-4 |
| Struktur Molekul |  |
| Kepadatan | 1.237g/cm3 |
| Titik didih | 289.4°C at 760 mmHg |
| Indeks bias | 1.511 |
| Titik nyala | 113°C |
| Tekanan wap | 0.000243mmHg at 25°C |
| Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 39493-62-4 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 