ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
345-70-0 3,3'-difluorobenzophenone |
|
Nama produk | 3,3'-difluorobenzophenone |
Nama Inggeris | 3,3'-difluorobenzophenone;bis(3-fluorophenyl)methanone |
MF | C13H8F2O |
Berat Molekul | 218.1988 |
InChI | InChI=1/C13H8F2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H |
CAS NO | 345-70-0 |
Struktur Molekul | |
Kepadatan | 1.239g/cm3 |
Titik lebur | 56-59℃ |
Titik didih | 316.2°C at 760 mmHg |
Indeks bias | 1.549 |
Titik nyala | 121.3°C |
Tekanan wap | 0.000415mmHg at 25°C |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |