Chemindex >344-14-9
MY ▼
344-14-9 dimethyl fluoromalonate |
|
| Nama produk | dimethyl fluoromalonate |
| Nama Inggeris | dimethyl fluoromalonate;Fluoromalonic acid dimethyl ester;dimethyl fluoropropanedioate;2-Fluoro-malonic acid dimethyl ester |
| MF | C5H7FO4 |
| Berat Molekul | 150.1051 |
| InChI | InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
| CAS NO | 344-14-9 |
| Struktur Molekul |  |
| Kepadatan | 1.211g/cm3 |
| Titik didih | 140.3°C at 760 mmHg |
| Indeks bias | 1.382 |
| Titik nyala | 38.4°C |
| Tekanan wap | 6.18mmHg at 25°C |
| Kod Risiko | R34##Causes burns.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati ChemNet Mall untuk bertanya tentang harga
dimethyl fluoromalonate 344-14-9
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 