Chemindex >341-02-6
MY ▼
341-02-6 Triphenylcarbenium tetrafluoroborate |
|
| Nama produk | Triphenylcarbenium tetrafluoroborate |
| Nama Inggeris | Triphenylcarbenium tetrafluoroborate;Trityl fluoroborate;Tritylium tetrafluoroborate;Trityl tetrafluoroborate;triphenylmethylium tetrafluoroborate |
| MF | C19H15BF4 |
| Berat Molekul | 330.127 |
| InChI | InChI=1/C19H15.BF4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)5/h1-15H;/q+1;-1 |
| CAS NO | 341-02-6 |
| EINECS | 206-433-3 |
| Struktur Molekul |  |
| Titik lebur | 205-215℃ |
| Cinta bahaya |  C##Corrosive:; |
| Kod Risiko | R34##Causes burns.:; |
| Keselamatan Penerangan | S25##Avoid contact with eyes.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 