Chemindex >33904-04-0
MY ▼
33904-04-0 3,4-Dimethoxyphenyl isothiocyanate |
|
| Nama produk | 3,4-Dimethoxyphenyl isothiocyanate |
| Nama Inggeris | 3,4-Dimethoxyphenyl isothiocyanate;3,4-Dimethoxyisothiocyanatobenzene;4-isothiocyanato-1,2-dimethoxybenzene |
| MF | C9H9NO2S |
| Berat Molekul | 195.2383 |
| InChI | InChI=1/C9H9NO2S/c1-11-8-4-3-7(10-6-13)5-9(8)12-2/h3-5H,1-2H3 |
| CAS NO | 33904-04-0 |
| Struktur Molekul |  |
| Kepadatan | 1.12g/cm3 |
| Titik lebur | 47-172℃ |
| Titik didih | 311°C at 760 mmHg |
| Indeks bias | 1.537 |
| Titik nyala | 141.9°C |
| Tekanan wap | 0.00106mmHg at 25°C |
| Cinta bahaya |  Xn##Harmful:; |
| Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 