Chemindex >332-51-4
MY ▼
(4-fluorophenylthio)acetic acid |
|
| Nama produk | (4-fluorophenylthio)acetic acid |
| Nama Inggeris | (4-fluorophenylthio)acetic acid;2-[(4-Fluorophenyl)thio]acetic acid;[(4-fluorophenyl)sulfanyl]acetic acid;[(4-fluorophenyl)sulfanyl]acetate;2-(4-Fluorophenylthio)acetic acid |
| MF | C8H6FO2S |
| Berat Molekul | 185.196 |
| InChI | InChI=1/C8H7FO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
| CAS NO | 332-51-4 |
| Struktur Molekul |  |
| Titik lebur | 76-79℃ |
| Titik didih | 315.4°C at 760 mmHg |
| Titik nyala | 144.5°C |
| Tekanan wap | 0.000185mmHg at 25°C |
| Cinta bahaya |  Xi##Irritant:; |
| Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 