ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306935-06-8 2-bromo-1-[5-(2-pyridinyl)-2-thienyl]-1-ethanone |
|
Nama produk | 2-bromo-1-[5-(2-pyridinyl)-2-thienyl]-1-ethanone |
Sinonim | 2-bromo-1-(5-pyridin-2-ylthiophen-2-yl)ethanone; |
Nama Inggeris | 2-bromo-1-[5-(2-pyridinyl)-2-thienyl]-1-ethanone;2-bromo-1-(5-pyridin-2-ylthiophen-2-yl)ethanone |
MF | C11H8BrNOS |
Berat Molekul | 282.1563 |
InChI | InChI=1/C11H8BrNOS/c12-7-9(14)11-5-4-10(15-11)8-3-1-2-6-13-8/h1-6H,7H2 |
CAS NO | 306935-06-8 |
Struktur Molekul | ![]() |
Kepadatan | 1.549g/cm3 |
Titik lebur | 122℃ |
Titik didih | 421.7°C at 760 mmHg |
Indeks bias | 1.633 |
Titik nyala | 208.8°C |
Tekanan wap | 2.55E-07mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |