ChemIndex - Pangkalan data CAS kimia percumaChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Cyclooctene oxide |
|
Nama produk | Cyclooctene oxide |
Nama Inggeris | Cyclooctene oxide;9-Oxabicyclo[6.1.0]nonane;Epoxycyclooctane~2-Oxabicyclo[6.1.0]nonane;Epoxycyclooctane;(1R,8S)-9-oxabicyclo[6.1.0]nonane;(1R,8R)-9-oxabicyclo[6.1.0]nonane;(1S,8S)-9-oxabicyclo[6.1.0]nonane |
MF | C8H14O |
Berat Molekul | 126.1962 |
InChI | InChI=1/C8H14O/c1-2-4-6-8-7(9-8)5-3-1/h7-8H,1-6H2/t7-,8-/m0/s1 |
CAS NO | 286-62-4 |
EINECS | 206-010-3 |
Struktur Molekul | |
Kepadatan | 0.958g/cm3 |
Titik lebur | 53-56℃ |
Titik didih | 189.3°C at 760 mmHg |
Indeks bias | 1.466 |
Titik nyala | 56.1°C |
Tekanan wap | 0.793mmHg at 25°C |
Cinta bahaya | Xn##Harmful:; |
Kod Risiko | R22##Harmful if swallowed.||R36/38##Irritating to eyes and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |