Chemindex >26413-58-1
MY ▼
26413-58-1 2-chloro-6-methylpyridine-4-carbonyl chloride |
|
| Nama produk | 2-chloro-6-methylpyridine-4-carbonyl chloride |
| Nama Inggeris | 2-chloro-6-methylpyridine-4-carbonyl chloride; |
| MF | C7H5Cl2NO |
| Berat Molekul | 190.0267 |
| InChI | InChI=1/C7H5Cl2NO/c1-4-2-5(7(9)11)3-6(8)10-4/h2-3H,1H3 |
| CAS NO | 26413-58-1 |
| Struktur Molekul |  |
| Kepadatan | 1.384g/cm3 |
| Titik didih | 270.3°C at 760 mmHg |
| Indeks bias | 1.558 |
| Titik nyala | 117.3°C |
| Tekanan wap | 0.00688mmHg at 25°C |
| Cinta bahaya |  C##Corrosive:; |
| Kod Risiko | R34##Causes burns.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 26413-58-1 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 