ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25859-29-4 asid decanoic, kompaun dengan 2-aminoethanol (1:1) |
|
Nama produk | asid decanoic, kompaun dengan 2-aminoethanol (1:1) |
Sinonim | Asid Decanoic, sebatian dengan 2-aminoethanol (1:1); 2-hydroxyethanaminium decanoate; |
Nama Inggeris | decanoic acid, compound with 2-aminoethanol (1:1);Decanoic acid, compound with 2-aminoethanol (1:1);2-hydroxyethanaminium decanoate |
MF | C12H27NO3 |
Berat Molekul | 233.3477 |
InChI | InChI=1/C10H20O2.C2H7NO/c1-2-3-4-5-6-7-8-9-10(11)12;3-1-2-4/h2-9H2,1H3,(H,11,12);4H,1-3H2 |
CAS NO | 25859-29-4 |
EINECS | 247-303-6 |
Struktur Molekul | ![]() |
Titik didih | 411.2°C at 760 mmHg |
Titik nyala | 202.5°C |
Tekanan wap | 1.77E-08mmHg at 25°C |
MSDS |