ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2249-28-7 4- 3-(Trifluoromethyl)phenyl]-4-piperidinol |
|
Nama produk | 4- 3-(Trifluoromethyl)phenyl]-4-piperidinol |
Nama Inggeris | 4- 3-(Trifluoromethyl)phenyl]-4-piperidinol;4-(alpha,alpha,alpha-Trifluoro-m-tolyl)-4-piperidinol;4-Hydroxy-4(3-Trifluoromethylphenyl)Piperidine |
MF | C12H15F3NO |
Berat Molekul | 246.2488096 |
InChI | InChI=1/C11H14FNO.CHF2/c12-10-3-1-2-9(8-10)11(14)4-6-13-7-5-11;1-3-2/h1-3,8,13-14H,4-7H2;1H |
CAS NO | 2249-28-7 |
EINECS | 218-840-3 |
Struktur Molekul | |
Titik lebur | 91-95℃ |
Cinta bahaya | Xi##Irritant:; |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |