ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
220497-88-1 (1S,2R,3S,4S)-2,3-Dihydroxy-4-(hydroxymethyl)-1-aminocyclopentane hydrochloride |
|
Nama produk | (1S,2R,3S,4S)-2,3-Dihydroxy-4-(hydroxymethyl)-1-aminocyclopentane hydrochloride |
Sinonim | (1S,2R,3S,4S)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentanaminium; |
Nama Inggeris | (1S,2R,3S,4S)-2,3-Dihydroxy-4-(hydroxymethyl)-1-aminocyclopentane hydrochloride;(1S,2R,3S,4S)-2,3-dihydroxy-4-(hydroxymethyl)cyclopentanaminium |
MF | C6H14NO3 |
Berat Molekul | 148.1797 |
InChI | InChI=1/C6H13NO3/c7-4-1-3(2-8)5(9)6(4)10/h3-6,8-10H,1-2,7H2/p+1/t3-,4-,5-,6+/m0/s1 |
CAS NO | 220497-88-1 |
Struktur Molekul | ![]() |
Titik lebur | 125.4℃ |
Titik didih | 300.855°C at 760 mmHg |
Titik nyala | 135.752°C |
Tekanan wap | 0mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |