Chemindex >20850-43-5
MY ▼
20850-43-5 5-(chloromethyl)-1,3-benzodioxole |
|
| Nama produk | 5-(chloromethyl)-1,3-benzodioxole |
| Nama Inggeris | 5-(chloromethyl)-1,3-benzodioxole;3,4-Methylenedioxybenzyl chloride;5-chloro-1,3-benzodioxole;Piperonal chloride |
| MF | C7H5ClO2 |
| Berat Molekul | 156.5664 |
| InChI | InChI=1/C7H5ClO2/c8-5-1-2-6-7(3-5)10-4-9-6/h1-3H,4H2 |
| CAS NO | 20850-43-5 |
| EINECS | 244-081-2 |
| Struktur Molekul |  |
| Kepadatan | 1.39g/cm3 |
| Titik didih | 186°C at 760 mmHg |
| Indeks bias | 1.577 |
| Titik nyala | 93.9°C |
| Tekanan wap | 0.931mmHg at 25°C |
| Cinta bahaya |  C##Corrosive:; |
| Kod Risiko | R34##Causes burns.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 