Chemindex >16215-21-7
MY ▼
16215-21-7 Butyl 3-mercaptopropionate |
|
| Nama produk | Butyl 3-mercaptopropionate |
| Nama Inggeris | Butyl 3-mercaptopropionate;Propanoic acid, 3-mercapto-, butyl ester;Butyl mercaptopropionate;NSC 54830;beta-Mercaptopropionic acid, butyl ester;Propionic acid, 3-mercapto-, butyl ester;butyl 3-sulfanylpropanoate |
| MF | C7H14O2S |
| Berat Molekul | 162.2499 |
| InChI | InChI=1/C7H14O2S/c1-2-3-5-9-7(8)4-6-10/h10H,2-6H2,1H3 |
| CAS NO | 16215-21-7 |
| EINECS | 240-343-5 |
| Struktur Molekul |  |
| Kepadatan | 1.003g/cm3 |
| Titik didih | 216.9°C at 760 mmHg |
| Indeks bias | 1.458 |
| Titik nyala | 93.3°C |
| Tekanan wap | 0.136mmHg at 25°C |
| Cinta bahaya |  Xn##Harmful:; |
| Kod Risiko | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 