ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13679-73-7 2-Acetyl-4-methylthiophene |
|
Nama produk | 2-Acetyl-4-methylthiophene |
Nama Inggeris | 2-Acetyl-4-methylthiophene;1-(4-Methyl-2-thienyl)ethan-1-one;AI3-61742;Ethanone, 1-(4-methyl-2-thienyl)-;1-(4-methylthiophen-2-yl)ethanone |
MF | C7H8OS |
Berat Molekul | 140.2028 |
InChI | InChI=1/C7H8OS/c1-5-3-7(6(2)8)9-4-5/h3-4H,1-2H3 |
CAS NO | 13679-73-7 |
EINECS | 237-180-7 |
Struktur Molekul | |
Kepadatan | 1.106g/cm3 |
Titik didih | 236.9°C at 760 mmHg |
Indeks bias | 1.535 |
Titik nyala | 97.1°C |
Tekanan wap | 0.0461mmHg at 25°C |
Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Keselamatan Penerangan | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |