ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13090-86-3 asid benzoik, kompaun dengan 2,2',2'-nitrilotriethanol (1:1) |
|
Nama produk | asid benzoik, kompaun dengan 2,2',2'-nitrilotriethanol (1:1) |
Sinonim | Asid benzoik, sebatian dengan 2,2',2'-nitrilotriethanol (1:1); Asid benzoik, akaun.dengan 2,2',2'-Nitrilotris(etanol) (1:1); 2-hydroxy-N,N-bis(2-hydroxyethyl)ethanaminium benzoate; |
Nama Inggeris | benzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Benzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Benzoic acid, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);2-hydroxy-N,N-bis(2-hydroxyethyl)ethanaminium benzoate |
MF | C13H21NO5 |
Berat Molekul | 271.3095 |
InChI | InChI=1/C7H6O2.C6H15NO3/c8-7(9)6-4-2-1-3-5-6;8-4-1-7(2-5-9)3-6-10/h1-5H,(H,8,9);8-10H,1-6H2 |
CAS NO | 13090-86-3 |
EINECS | 236-002-5 |
Struktur Molekul | ![]() |
Titik didih | 518.5°C at 760 mmHg |
Titik nyala | 267.4°C |
Tekanan wap | 1.41E-11mmHg at 25°C |
MSDS |