Chemindex >1206-15-1
MY ▼
1206-15-1 1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile |
|
| Nama produk | 1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile |
| Sinonim | 1-(4-Methoxyphenyl)cyclopentanecarbonitrile |
| Nama Inggeris | 1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile;1-(4-Methoxyphenyl)cyclopentanecarbonitrile |
| MF | C13H15NO |
| Berat Molekul | 201.2643 |
| InChI | InChI=1/C13H15NO/c1-15-12-6-4-11(5-7-12)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
| CAS NO | 1206-15-1 |
| EINECS | 214-890-5 |
| Struktur Molekul |  |
| Kepadatan | 1.07g/cm3 |
| Titik didih | 346.4°C at 760 mmHg |
| Indeks bias | 1.543 |
| Titik nyala | 146.2°C |
| Tekanan wap | 5.76E-05mmHg at 25°C |
| Cinta bahaya |  Xn##Harmful:; |
| Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 