Chemindex >104-18-7
MY ▼
(4-Aminophenylthio)acetic acid |
|
| Nama produk | (4-Aminophenylthio)acetic acid |
| Nama Inggeris | (4-Aminophenylthio)acetic acid;2-(4-Aminophenylthio)acetic acid;4-Aminothiophenoxyacetic acid;[(4-aminophenyl)sulfanyl]acetic acid;[(4-aminophenyl)sulfanyl]acetate |
| MF | C8H8NO2S |
| Berat Molekul | 182.2202 |
| InChI | InChI=1/C8H9NO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5,9H2,(H,10,11)/p-1 |
| CAS NO | 104-18-7 |
| EINECS | 203-182-1 |
| Struktur Molekul |  |
| Titik didih | 405.3°C at 760 mmHg |
| Titik nyala | 198.9°C |
| Tekanan wap | 2.69E-07mmHg at 25°C |
| Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 