ChemIndex - Pangkalan data CAS kimia percumaChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
p-Tolyl disulfide |
|
Nama produk | p-Tolyl disulfide |
Nama Inggeris | p-Tolyl disulfide; |
MF | C14H14S2 |
Berat Molekul | 246.391 |
InChI | InChI=1/C14H14S2/c1-11-3-7-13(8-4-11)15-16-14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
CAS NO | 103-19-5 |
EINECS | 203-087-5 |
Struktur Molekul | |
Kepadatan | 1.17g/cm3 |
Titik lebur | 43-46℃ |
Titik didih | 349.5°C at 760 mmHg |
Indeks bias | 1.649 |
Titik nyala | 192.6°C |
Tekanan wap | 9.46E-05mmHg at 25°C |
Cinta bahaya | Xi##Irritant:; |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |