ChemIndex - Pangkalan data CAS kimia percumaChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
N-Phenylurethane |
|
Nama produk | N-Phenylurethane |
Nama Inggeris | N-Phenylurethane;Ethyl carbanilate~Ethyl N-phenylcarbamate;ethyl phenylcarbamate |
MF | C9H11NO2 |
Berat Molekul | 165.1891 |
InChI | InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
CAS NO | 101-99-5 |
EINECS | 202-995-9 |
Struktur Molekul | |
Kepadatan | 1.136g/cm3 |
Titik didih | 238°C at 760 mmHg |
Indeks bias | 1.558 |
Titik nyala | 79.2°C |
Tekanan wap | 0.0434mmHg at 25°C |
Kod Risiko | R40##Possible risks of irreversible effects.:; |
Keselamatan Penerangan | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |