ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
101-89-3 Fast Garnet GBC salt |
|
Nama produk | Fast Garnet GBC salt |
Nama Inggeris | Fast Garnet GBC salt;Fast Garnet GBC sulfate salt;2-Methyl-4-(o-tolylazo)benzenediazonium hydrogen sulphate;Fast Garnet GBC Salt;Benzenediazonium, 2-methyl-4-((2-methylphenyl)azo)-, sulfate (1:1);Benzenediazonium,2-methyl-4-[(2-methylphenyl) azo]-,sulfate (1:1); |
MF | C14H14N4O4S |
Berat Molekul | 334.3504 |
InChI | InChI=1/C14H13N4.H2O4S/c1-10-5-3-4-6-14(10)18-17-12-7-8-13(16-15)11(2)9-12;1-5(2,3)4/h3-9H,1-2H3;(H2,1,2,3,4)/q+1;/p-1/b18-17+; |
CAS NO | 101-89-3 |
EINECS | 202-985-4 |
Struktur Molekul | ![]() |
Cinta bahaya | |
Kod Risiko | R33##Danger of cummulative effects.:; |
Keselamatan Penerangan | S24/25##Avoid contact with skin and eyes.:; |
MSDS |