ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
101-17-7 3-Chlorodiphenylamine |
|
Nama produk | 3-Chlorodiphenylamine |
Nama Inggeris | 3-Chlorodiphenylamine;Benzenamine, 3-chloro-N-phenyl-;3-chloro-N-phenylaniline;3-Chloro-N-phenyl-benzenamine;N-(3-chlorophenyl)aniline |
MF | C12H10ClN |
Berat Molekul | 203.6675 |
InChI | InChI=1/C12H10ClN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H |
CAS NO | 101-17-7 |
EINECS | 202-922-0 |
Struktur Molekul | |
Kepadatan | 1.216g/cm3 |
Titik didih | 337.8°C at 760 mmHg |
Indeks bias | 1.642 |
Titik nyala | 147.4°C |
Tekanan wap | 0.000102mmHg at 25°C |
Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Keselamatan Penerangan | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |