ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99-62-7 1,3-Diisopropylbenzene |
|
상품명칭 | 1,3-Diisopropylbenzene |
영문 이름 | 1,3-Diisopropylbenzene;1,3-Bis(1-methylethyl)benzene;AI3-08224;BRN 1905828;Benzene, 1,3-bis(1-methylethyl)-;Benzene, m-diisopropyl-;HSDB 5325;m-Diisopropylbenzene;m-Diisopropylbenzol;1,3-di(propan-2-yl)benzene |
분자식 | C12H18 |
분자량 | 162.2713 |
InChI | InChI=1/C12H18/c1-9(2)11-6-5-7-12(8-11)10(3)4/h5-10H,1-4H3 |
cas번호 | 99-62-7 |
EC번호 | 202-773-1 |
분자 구조 | |
밀도 | 0.855g/cm3 |
녹는 점 | -63℃ |
비등점 | 203.2°C at 760 mmHg |
굴절 지수 | 1.488 |
인화점 | 76.7°C |
증기압 | 0.401mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |