Chemindex > 99-48-9
KR ▼
(-)-Carveol |
|
| 상품명칭 | (-)-Carveol |
| 영문 이름 | (-)-Carveol;p-Mentha-6,8-dien-2-ol;Carveol;1-Methyl-4-isopropenyl-6-cyclohexen-2-ol;2-06-00-00102 (Beilstein Handbook Reference);2-Cyclohexen-1-ol, 2-methyl-5-(1-methylethenyl)-;2-Methyl-5-(1-methylethenyl)-2-cyclohexen-1-ol;2-Methyl-5-isopropenyl-2-cyclohexen-1-ol;5-Isopropenyl-2-methyl-2-cyclohexen-1-ol;AI3-27596;BRN 1861032;CCRIS 6219;EINECS 202-757-4;FEMA No. 2247;NSC 68313;UNII-1L9KXT85R9;p-Mentha-1,8-dien-6-ol;p-Mentha-1(6),8-dien-2-ol;2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-ol;(1S,5S)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-ol;(1R,5S)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-ol;(5R)-2-methyl-5-(1-methylethenyl)cyclohex-2-en-1-ol |
| 분자식 | C10H16O |
| 분자량 | 152.2334 |
| InChI | InChI=1/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9-11H,1,5-6H2,2-3H3/t9-,10?/m1/s1 |
| cas번호 | 99-48-9;20307-86-2;22567-18-6 |
| EC번호 | 202-757-4 |
| 분자 구조 |  |
| 밀도 | 0.949g/cm3 |
| 비등점 | 231.5°C at 760 mmHg |
| 굴절 지수 | 1.497 |
| 인화점 | 91.2°C |
| 증기압 | 0.0117mmHg at 25°C |
| 보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.ChemNet Mall을 방문하여
(-)-Carveol 99-48-9;20307-86-2;22567-18-6 의 가격에 대해 문의하십시오.
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 