ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99-42-3 Methyl 4-hydroxy-3-nitrobenzoate |
|
상품명칭 | Methyl 4-hydroxy-3-nitrobenzoate |
영문 이름 | Methyl 4-hydroxy-3-nitrobenzoate;4-Hydroxy-3-nitrobenzoic acid methyl ester;Methyl 3-nitro-4-hydroxybenzoate;4-(methoxycarbonyl)-2-nitrophenolate;3-nitro-4-hydroxymethyl benzoate |
분자식 | C8H6NO5 |
분자량 | 196.1375 |
InChI | InChI=1/C8H7NO5/c1-14-8(11)5-2-3-7(10)6(4-5)9(12)13/h2-4,10H,1H3/p-1 |
cas번호 | 99-42-3 |
EC번호 | 202-755-3 |
분자 구조 | ![]() |
녹는 점 | 74-76℃ |
비등점 | 311.1°C at 760 mmHg |
인화점 | 141.9°C |
증기압 | 0.000315mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |