N-(4-amino-5-methoxy-2-methylphenyl)benzamide |
상품명칭 |
N-(4-amino-5-methoxy-2-methylphenyl)benzamide |
영문 이름 |
N-(4-amino-5-methoxy-2-methylphenyl)benzamide;Benzamide, N-(4-amino-5-methoxy-2-methylphenyl)-;4'-Amino-5'-methoxy-2'-methylbenzanilide;4-amino-5-methoxy-2-methyl-N-phenylbenzamide;Fast Violet Base B;FAST VIOLER B BASE |
분자식 |
C15H16N2O2 |
분자량 |
256.2997 |
InChI |
InChI=1/C15H16N2O2/c1-10-8-13(16)14(19-2)9-12(10)15(18)17-11-6-4-3-5-7-11/h3-9H,16H2,1-2H3,(H,17,18) |
cas번호 |
99-21-8 |
EC번호 |
202-740-1 |
분자 구조 |
|
밀도 |
1.215g/cm3 |
녹는 점 |
185℃ |
비등점 |
384.7°C at 760 mmHg |
굴절 지수 |
1.646 |
인화점 |
186.5°C |
증기압 |
4.01E-06mmHg at 25°C |
보안 규칙 |
S24/25##Avoid contact with skin and eyes.:;
|
MSDS |
Material Safety Data Sheet |