ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99-20-7 D-Trehalose anhydrous |
|
상품명칭 | D-Trehalose anhydrous |
영문 이름 | D-Trehalose anhydrous;Trehalose;alpha-D-Trehalose;alpha-D-glucopyranosyl alpha-D-glucopyranoside;Trehalose;D(+)Trehalose;D-(+)-Trehalose;α-L-glucopyranosyl;α-D-glucopyranoside;Trehalose anhydrous |
분자식 | C12H22O11 |
분자량 | 342.2965 |
InChI | InChI=1/C12H22O11/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
cas번호 | 99-20-7 |
EC번호 | 202-739-6 |
분자 구조 | |
밀도 | 1.76g/cm3 |
녹는 점 | 214-216℃ |
비등점 | 675.4°C at 760 mmHg |
굴절 지수 | 1.652 |
인화점 | 362.3°C |
증기압 | 3.87E-21mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |