ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
97158-49-1 벤조티아졸-2(3H)-티온, 나트륨염, 2-아미노에탄올과 화합물 |
|
상품명칭 | 벤조티아졸-2(3H)-티온, 나트륨염, 2-아미노에탄올과 화합물 |
별명 | 벤조 티아 졸 -2 (3H)-thione, 나트륨 염, 2- 아미노 에탄올과 화합물; 나트륨 2- 아미노 에탄올 3H-1,3- 벤조 티아 졸 -2- 티온; |
영문 이름 | benzothiazole-2(3H)-thione, sodium salt, compound with 2-aminoethanol;Benzothiazole-2(3H)-thione, sodium salt, compound with 2-aminoethanol;sodium 2-aminoethanol 3H-1,3-benzothiazole-2-thione |
분자식 | C9H12N2NaOS2 |
분자량 | 251.3236 |
InChI | InChI=1/C7H5NS2.C2H7NO.Na/c9-7-8-5-3-1-2-4-6(5)10-7;3-1-2-4;/h1-4H,(H,8,9);4H,1-3H2;/q;;+1 |
cas번호 | 97158-49-1 |
EC번호 | 306-379-1 |
분자 구조 | |
MSDS |