Chemindex > 97-95-0
KR ▼
97-95-0 2-Ethyl-1-butanol |
|
| 상품명칭 | 2-Ethyl-1-butanol |
| 영문 이름 | 2-Ethyl-1-butanol;2-Ethylbutyl alcohol;2-ethylbutan-1-ol |
| 분자식 | C6H14O |
| 분자량 | 102.1748 |
| InChI | InChI=1/C6H14O/c1-3-6(4-2)5-7/h6-7H,3-5H2,1-2H3 |
| cas번호 | 97-95-0 |
| EC번호 | 202-621-4 |
| 분자 구조 |  |
| 밀도 | 0.814g/cm3 |
| 녹는 점 | -15℃ |
| 비등점 | 146.5°C at 760 mmHg |
| 굴절 지수 | 1.413 |
| 인화점 | 58.3°C |
| 증기압 | 1.81mmHg at 25°C |
| 위험성 표시 |  Xn##Harmful:; |
| 리스크 규칙 | R21/22##Harmful in contact with skin and if swallowed.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.ChemNet Mall을 방문하여
2-Ethyl-1-butanol 97-95-0 의 가격에 대해 문의하십시오.
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 