2,3-heptanedione |
|
상품명칭 | 2,3-heptanedione |
영문 이름 | 2,3-heptanedione;2,3-Heptanedione;Acetyl pentanoyl;Acetyl valeryl;FEMA No. 2543;NSC 31668;UNII-DK55DDE86P;Valerylacetyl;heptane-2,3-dione |
분자식 | C7H12O2 |
분자량 | 128.169 |
InChI | InChI=1/C7H12O2/c1-3-4-5-7(9)6(2)8/h3-5H2,1-2H3 |
cas번호 | 96-04-8 |
EC번호 | 202-472-5 |
분자 구조 | |
밀도 | 0.926g/cm3 |
비등점 | 149.7°C at 760 mmHg |
굴절 지수 | 1.413 |
인화점 | 45°C |
증기압 | 3.98mmHg at 25°C |
리스크 규칙 | R10##Flammable.:; |
보안 규칙 | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |