ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
95-63-6 1,2,4-Trimethylbenzene |
|
상품명칭 | 1,2,4-Trimethylbenzene |
영문 이름 | 1,2,4-Trimethylbenzene;Pseudocumene;1,2,4-Trimethylbenzere;1,3,4-Trimethylbenzene |
분자식 | C9H12 |
분자량 | 120.19 |
InChI | InChI=1/C9H12/c1-7-4-5-8(2)9(3)6-7/h4-6H,1-3H3 |
cas번호 | 95-63-6 |
EC번호 | 202-436-9 |
분자 구조 | ![]() |
밀도 | 0.88 |
녹는 점 | -44℃ |
비등점 | 168℃ |
굴절 지수 | 1.503-1.505 |
인화점 | 48℃ |
위험성 표시 | |
리스크 규칙 | R10##Flammable.||R20##Harmful by inhalation.||R36/37/38##Irritating to eyes, respiratory system and skin.||R51/53##Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:; |
MSDS |