ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
95-12-5 5-Norbornene-2-methanol |
|
상품명칭 | 5-Norbornene-2-methanol |
영문 이름 | 5-Norbornene-2-methanol;5-Norbornene-2-methanol,mixture of endo and exo;2-Hydroxymethyl-5-norbornene;5-Norborene-2-methanol;5-norbornene-2-methanol(NMO)mixture of endo and exo;bicyclo[2.2.1]hept-5-en-2-ylmethanol;(1R,2S,4R)-bicyclo[2.2.1]hept-5-en-2-ylmethanol |
분자식 | C8H12O |
분자량 | 124.1803 |
InChI | InChI=1/C8H12O/c9-5-8-4-6-1-2-7(8)3-6/h1-2,6-9H,3-5H2/t6-,7+,8-/m1/s1 |
cas번호 | 95-12-5 |
EC번호 | 202-392-0 |
분자 구조 | |
밀도 | 1.06g/cm3 |
비등점 | 189.2°C at 760 mmHg |
굴절 지수 | 1.53 |
인화점 | 81.6°C |
증기압 | 0.158mmHg at 25°C |
위험성 표시 | Xn##Harmful:; |
리스크 규칙 | R20/21/22:; |
보안 규칙 | S36/37/39||S45:; |
MSDS |